C16H31N3O2 — CID 58136032
butyl 1-methyl-4-(1-methylpiperidin-4-yl)piperazine-2-carboxylate (PubChem CID 58136032) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is butyl 1-methyl-4-(1-methylpiperidin-4-yl)piperazine-2-carboxylate.
| Compound Name | butyl 1-methyl-4-(1-methylpiperidin-4-yl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 58136032 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | butyl 1-methyl-4-(1-methylpiperidin-4-yl)piperazine-2-carboxylate |
| SMILES | CCCCOC(=O)C1CN(C2CCN(C)CC2)CCN1C |
| InChI | InChI=1S/C16H31N3O2/c1-4-5-12-21-16(20)15-13-19(11-10-18(15)3)14-6-8-17(2)9-7-14/h14-15H,4-13H2,1-3H3 |
| InChIKey | GHNSMNDWMFLKOI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|