About tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate
tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate (PubChem CID 58136426) has the molecular formula C18H24F2O2
and a molecular weight of 310.38 g/mol. Its IUPAC name is tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate |
| PubChem CID | 58136426 |
| Molecular Formula | C18H24F2O2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(C(=O)OC(C)(C)C)C2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C18H24F2O2/c1-12-5-7-13(8-6-12)15(16(21)22-17(2,3)4)14-9-10-18(19,20)11-14/h5-8,14-15H,9-11H2,1-4H3 |
| InChIKey | IVOPICYLODWUHI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate?
The IUPAC name of tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate (CID 58136426) is tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate.
What is the SMILES notation for tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate?
The canonical SMILES for tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate is Cc1ccc(C(C(=O)OC(C)(C)C)C2CCC(F)(F)C2)cc1.
What is the InChIKey of tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate?
The InChIKey is IVOPICYLODWUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F2O2/c1-12-5-7-13(8-6-12)15(16(21)22-17(2,3)4)14-9-10-18(19,20)11-14/h5-8,14-15H,9-11H2,1-4H3.
What are the key properties of tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate?
tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate has a molecular weight of 310.38 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3,3-difluorocyclopentyl)-2-(4-methylphenyl)acetate is sourced from PubChem (CID 58136426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).