C7H9N5 — CID 58136866
6-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine (PubChem CID 58136866) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is 6-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine.
| Compound Name | 6-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
|---|---|
| PubChem CID | 58136866 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 6-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
| SMILES | CCc1ccc2nnc(N)n2n1 |
| InChI | InChI=1S/C7H9N5/c1-2-5-3-4-6-9-10-7(8)12(6)11-5/h3-4H,2H2,1H3,(H2,8,10) |
| InChIKey | VOROJXAKCCHNCJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |