About (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine]
(3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] (PubChem CID 58137278) has the molecular formula C16H20BrN
and a molecular weight of 306.25 g/mol. Its IUPAC name is (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine].
Molecular Properties
| Compound Name | (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] |
| PubChem CID | 58137278 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] |
| SMILES | CC/C=C1/CC2(CCNCC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C16H20BrN/c1-2-4-12-11-16(7-9-18-10-8-16)15-13(12)5-3-6-14(15)17/h3-6,18H,2,7-11H2,1H3/b12-4- |
| InChIKey | CKXPXQMEQPUWNA-QCDXTXTGSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine]?
The IUPAC name of (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] (CID 58137278) is (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine].
What is the SMILES notation for (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine]?
The canonical SMILES for (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] is CC/C=C1/CC2(CCNCC2)c2c(Br)cccc21.
What is the InChIKey of (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine]?
The InChIKey is CKXPXQMEQPUWNA-QCDXTXTGSA-N. The full InChI is InChI=1S/C16H20BrN/c1-2-4-12-11-16(7-9-18-10-8-16)15-13(12)5-3-6-14(15)17/h3-6,18H,2,7-11H2,1H3/b12-4-.
What are the key properties of (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine]?
(3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] has a molecular weight of 306.25 g/mol, XLogP of 4.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-7-bromo-3-propylidenespiro[2H-indene-1,4'-piperidine] is sourced from PubChem (CID 58137278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).