About [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine
[6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine (PubChem CID 58137371) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine.
Molecular Properties
| Compound Name | [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine |
| PubChem CID | 58137371 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine |
| SMILES | COc1nnc(CN)cc1OCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2/c1-15-7-6(16-4-8(9,10)11)2-5(3-12)13-14-7/h2H,3-4,12H2,1H3 |
| InChIKey | PRURQUBUQYJEEH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine?
The IUPAC name of [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine (CID 58137371) is [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine.
What is the SMILES notation for [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine?
The canonical SMILES for [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine is COc1nnc(CN)cc1OCC(F)(F)F.
What is the InChIKey of [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine?
The InChIKey is PRURQUBUQYJEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c1-15-7-6(16-4-8(9,10)11)2-5(3-12)13-14-7/h2H,3-4,12H2,1H3.
What are the key properties of [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine?
[6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine has a molecular weight of 237.18 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methoxy-5-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine is sourced from PubChem (CID 58137371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).