About 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone
2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone (PubChem CID 58137459) has the molecular formula C12H13BrF5NOS
and a molecular weight of 394.20 g/mol. Its IUPAC name is 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone |
| PubChem CID | 58137459 |
| Molecular Formula | C12H13BrF5NOS |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone |
| SMILES | O=C(CBr)c1cc(N2CCCC2)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C12H13BrF5NOS/c13-8-12(20)9-5-10(19-3-1-2-4-19)7-11(6-9)21(14,15,16,17)18/h5-7H,1-4,8H2 |
| InChIKey | FIXADWHRPQRYLC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone?
The IUPAC name of 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone (CID 58137459) is 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone.
What is the SMILES notation for 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone?
The canonical SMILES for 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone is O=C(CBr)c1cc(N2CCCC2)cc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone?
The InChIKey is FIXADWHRPQRYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF5NOS/c13-8-12(20)9-5-10(19-3-1-2-4-19)7-11(6-9)21(14,15,16,17)18/h5-7H,1-4,8H2.
What are the key properties of 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone?
2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone has a molecular weight of 394.20 g/mol, XLogP of 5.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[3-(pentafluoro-λ6-sulfanyl)-5-pyrrolidin-1-ylphenyl]ethanone is sourced from PubChem (CID 58137459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).