About ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate
ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate (PubChem CID 58137754) has the molecular formula C19H18N4O3S
and a molecular weight of 382.45 g/mol. Its IUPAC name is ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate |
| PubChem CID | 58137754 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1CNC(=O)c1ccc(Nc2nccs2)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-2-26-18(25)15-4-3-9-20-16(15)12-22-17(24)13-5-7-14(8-6-13)23-19-21-10-11-27-19/h3-11H,2,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | FZMYLLDLGKHBJY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate?
The IUPAC name of ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate (CID 58137754) is ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate?
The canonical SMILES for ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate is CCOC(=O)c1cccnc1CNC(=O)c1ccc(Nc2nccs2)cc1.
What is the InChIKey of ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate?
The InChIKey is FZMYLLDLGKHBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O3S/c1-2-26-18(25)15-4-3-9-20-16(15)12-22-17(24)13-5-7-14(8-6-13)23-19-21-10-11-27-19/h3-11H,2,12H2,1H3,(H,21,23)(H,22,24).
What are the key properties of ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate?
ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate has a molecular weight of 382.45 g/mol, XLogP of 3.39, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[[4-(1,3-thiazol-2-ylamino)benzoyl]amino]methyl]pyridine-3-carboxylate is sourced from PubChem (CID 58137754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).