methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate

C10H17F2NO2 — CID 58137875

IUPACmethyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate
SMILESCNC(C(=O)OC)C1CCC(F)(F)CC1
InChIInChI=1S/C10H17F2NO2/c1-13-8(9(14)15-2)7-3-5-10(11,12)6-4-7/h7-8,13H,3-6H2,1-2H3
InChIKeyZVVNYLKASMHLBA-UHFFFAOYSA-N
MW221.25 g/mol
LogP1.57
Rot. Bonds3

About methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate

methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate (PubChem CID 58137875) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate.

Molecular Properties

Compound Namemethyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate
PubChem CID58137875
Molecular FormulaC10H17F2NO2
Molecular Weight221.25 g/mol
Exact Mass221.12
IUPAC Namemethyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate
SMILESCNC(C(=O)OC)C1CCC(F)(F)CC1
InChIInChI=1S/C10H17F2NO2/c1-13-8(9(14)15-2)7-3-5-10(11,12)6-4-7/h7-8,13H,3-6H2,1-2H3
InChIKeyZVVNYLKASMHLBA-UHFFFAOYSA-N
XLogP1.57
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.25
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate?
The IUPAC name of methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate (CID 58137875) is methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate.
What is the SMILES notation for methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate?
The canonical SMILES for methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate is CNC(C(=O)OC)C1CCC(F)(F)CC1.
What is the InChIKey of methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate?
The InChIKey is ZVVNYLKASMHLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO2/c1-13-8(9(14)15-2)7-3-5-10(11,12)6-4-7/h7-8,13H,3-6H2,1-2H3.
What are the key properties of methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate?
methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate has a molecular weight of 221.25 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,4-difluorocyclohexyl)-2-(methylamino)acetate is sourced from PubChem (CID 58137875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).