C32H43N7O3S — CID 58137976
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone (PubChem CID 58137976) has the molecular formula C32H43N7O3S and a molecular weight of 605.81 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 58137976 |
| Molecular Formula | C32H43N7O3S |
| Molecular Weight | 605.81 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
| SMILES | CS(=O)(=O)C1CCN(c2cccc3c2ccn3-c2ccnc(NC3CCC(C(=O)N4CCN5CCCC5C4)CC3)n2)CC1 |
| InChI | InChI=1S/C32H43N7O3S/c1-43(41,42)26-12-17-37(18-13-26)28-5-2-6-29-27(28)14-19-39(29)30-11-15-33-32(35-30)34-24-9-7-23(8-10-24)31(40)38-21-20-36-16-3-4-25(36)22-38/h2,5-6,11,14-15,19,23-26H,3-4,7-10,12-13,16-18,20-22H2,1H3,(H,33,34,35) |
| InChIKey | NULLRBUZUHEOJC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |