About 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane]
2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 58138455) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane].
Molecular Properties
| Compound Name | 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| PubChem CID | 58138455 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | CC1CCCCC12CNc1ccccc12 |
| InChI | InChI=1S/C14H19N/c1-11-6-4-5-9-14(11)10-15-13-8-3-2-7-12(13)14/h2-3,7-8,11,15H,4-6,9-10H2,1H3 |
| InChIKey | TXHRMHZLWIFOOD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane]?
The IUPAC name of 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] (CID 58138455) is 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane].
What is the SMILES notation for 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane]?
The canonical SMILES for 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] is CC1CCCCC12CNc1ccccc12.
What is the InChIKey of 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane]?
The InChIKey is TXHRMHZLWIFOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-11-6-4-5-9-14(11)10-15-13-8-3-2-7-12(13)14/h2-3,7-8,11,15H,4-6,9-10H2,1H3.
What are the key properties of 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane]?
2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] has a molecular weight of 201.31 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] is sourced from PubChem (CID 58138455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).