C14H19N — CID 58138455
2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 58138455) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 58138455 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2'-methylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | CC1CCCCC12CNc1ccccc12 |
| InChI | InChI=1S/C14H19N/c1-11-6-4-5-9-14(11)10-15-13-8-3-2-7-12(13)14/h2-3,7-8,11,15H,4-6,9-10H2,1H3 |
| InChIKey | TXHRMHZLWIFOOD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |