C22H19FN4O3S — CID 58138841
1-(4-fluorophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]indazole-4-carboxamide (PubChem CID 58138841) has the molecular formula C22H19FN4O3S and a molecular weight of 438.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]indazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 58138841 |
| Molecular Formula | C22H19FN4O3S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]indazole-4-carboxamide |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)c2cccc3c2cnn3-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19FN4O3S/c1-24-31(29,30)18-5-2-4-15(12-18)13-25-22(28)19-6-3-7-21-20(19)14-26-27(21)17-10-8-16(23)9-11-17/h2-12,14,24H,13H2,1H3,(H,25,28) |
| InChIKey | QBCYWHLSAHDGHB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |