C21H14F4N4O — CID 58138868
1-(6-fluoro-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide (PubChem CID 58138868) has the molecular formula C21H14F4N4O and a molecular weight of 414.36 g/mol. Its IUPAC name is 1-(6-fluoro-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide.
| Compound Name | 1-(6-fluoro-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 58138868 |
| Molecular Formula | C21H14F4N4O |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 1-(6-fluoro-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1cccc2c1cnn2-c1ccc(F)nc1 |
| InChI | InChI=1S/C21H14F4N4O/c22-19-8-7-15(11-26-19)29-18-6-2-5-16(17(18)12-28-29)20(30)27-10-13-3-1-4-14(9-13)21(23,24)25/h1-9,11-12H,10H2,(H,27,30) |
| InChIKey | ACXKPCJZZHOFID-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|