About 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one
1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one (PubChem CID 58139217) has the molecular formula C6H6ClNOS2
and a molecular weight of 207.71 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one.
Molecular Properties
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one |
| PubChem CID | 58139217 |
| Molecular Formula | C6H6ClNOS2 |
| Molecular Weight | 207.71 g/mol |
| Exact Mass | 206.96 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one |
| SMILES | O=C(CS)Cc1ncc(Cl)s1 |
| InChI | InChI=1S/C6H6ClNOS2/c7-5-2-8-6(11-5)1-4(9)3-10/h2,10H,1,3H2 |
| InChIKey | NZFXAGSBYJIEOD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one?
The IUPAC name of 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one (CID 58139217) is 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one.
What is the SMILES notation for 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one?
The canonical SMILES for 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one is O=C(CS)Cc1ncc(Cl)s1.
What is the InChIKey of 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one?
The InChIKey is NZFXAGSBYJIEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNOS2/c7-5-2-8-6(11-5)1-4(9)3-10/h2,10H,1,3H2.
What are the key properties of 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one?
1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one has a molecular weight of 207.71 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-1,3-thiazol-2-yl)-3-sulfanylpropan-2-one is sourced from PubChem (CID 58139217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).