C13H14O5S — CID 58139250
dimethyl 2-(2-oxo-3-sulfanylpropyl)benzene-1,4-dicarboxylate (PubChem CID 58139250) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is dimethyl 2-(2-oxo-3-sulfanylpropyl)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(2-oxo-3-sulfanylpropyl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58139250 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | dimethyl 2-(2-oxo-3-sulfanylpropyl)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(CC(=O)CS)c1 |
| InChI | InChI=1S/C13H14O5S/c1-17-12(15)8-3-4-11(13(16)18-2)9(5-8)6-10(14)7-19/h3-5,19H,6-7H2,1-2H3 |
| InChIKey | UROMEEKWVHCMNH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|