C31H45NO2Si — CID 58139519
(3S,6Z,9S,11Z)-3-amino-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyltrideca-6,11-dien-4-one (PubChem CID 58139519) has the molecular formula C31H45NO2Si and a molecular weight of 491.79 g/mol. Its IUPAC name is (3S,6Z,9S,11Z)-3-amino-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyltrideca-6,11-dien-4-one.
| Compound Name | (3S,6Z,9S,11Z)-3-amino-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyltrideca-6,11-dien-4-one |
|---|---|
| PubChem CID | 58139519 |
| Molecular Formula | C31H45NO2Si |
| Molecular Weight | 491.79 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | (3S,6Z,9S,11Z)-3-amino-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyltrideca-6,11-dien-4-one |
| SMILES | C/C=C\C[C@@H](C/C=C\CC(=O)[C@@H](N)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H45NO2Si/c1-8-9-18-25(19-16-17-24-28(33)29(32)30(2,3)4)34-35(31(5,6)7,26-20-12-10-13-21-26)27-22-14-11-15-23-27/h8-17,20-23,25,29H,18-19,24,32H2,1-7H3/b9-8-,17-16-/t25-,29+/m0/s1 |
| InChIKey | PLXMFOAKQPRZDF-WBZNCWSOSA-N |
| XLogP | 6.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.79 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|