C36H48ClNO3Si — CID 58139520
N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-4-ynamide (PubChem CID 58139520) has the molecular formula C36H48ClNO3Si and a molecular weight of 606.32 g/mol. Its IUPAC name is N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-4-ynamide.
| Compound Name | N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 58139520 |
| Molecular Formula | C36H48ClNO3Si |
| Molecular Weight | 606.32 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-4-ynamide |
| SMILES | C#CCCC(=O)N[C@H](C(=O)C/C=C\C[C@H](C/C=C(\C)Cl)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H48ClNO3Si/c1-9-10-25-33(40)38-34(35(3,4)5)32(39)24-18-17-19-29(27-26-28(2)37)41-42(36(6,7)8,30-20-13-11-14-21-30)31-22-15-12-16-23-31/h1,11-18,20-23,26,29,34H,10,19,24-25,27H2,2-8H3,(H,38,40)/b18-17-,28-26+/t29-,34-/m1/s1 |
| InChIKey | HFZCSYHEESODTK-PAVONVDPSA-N |
| XLogP | 7.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.32 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|