C18H33IO4Si — CID 58139533
methyl (5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methoxy-6-methylnona-2,7-dienoate (PubChem CID 58139533) has the molecular formula C18H33IO4Si and a molecular weight of 468.45 g/mol. Its IUPAC name is methyl (5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methoxy-6-methylnona-2,7-dienoate.
| Compound Name | methyl (5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methoxy-6-methylnona-2,7-dienoate |
|---|---|
| PubChem CID | 58139533 |
| Molecular Formula | C18H33IO4Si |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | methyl (5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methoxy-6-methylnona-2,7-dienoate |
| SMILES | COC(=O)C(=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\C)I)OC |
| InChI | InChI=1S/C18H33IO4Si/c1-13(12-14(2)19)15(23-24(8,9)18(3,4)5)10-11-16(21-6)17(20)22-7/h11-13,15H,10H2,1-9H3/b14-12+,16-11?/t13-,15-/m0/s1 |
| InChIKey | VHZACUXLVAJKSN-UTOIAKPNSA-N |
| XLogP | 5.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|