C30H43ClN2O2Si — CID 58139540
(2S)-2-amino-N-[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3,3-dimethylbutanamide (PubChem CID 58139540) has the molecular formula C30H43ClN2O2Si and a molecular weight of 527.23 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 58139540 |
| Molecular Formula | C30H43ClN2O2Si |
| Molecular Weight | 527.23 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | (2S)-2-amino-N-[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3,3-dimethylbutanamide |
| SMILES | C/C(Cl)=C\C[C@@H](C/C=C\NC(=O)[C@@H](N)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H43ClN2O2Si/c1-23(31)20-21-24(15-14-22-33-28(34)27(32)29(2,3)4)35-36(30(5,6)7,25-16-10-8-11-17-25)26-18-12-9-13-19-26/h8-14,16-20,22,24,27H,15,21,32H2,1-7H3,(H,33,34)/b22-14-,23-20+/t24-,27-/m1/s1 |
| InChIKey | CFMJMILVGXRWPV-HAIZLROSSA-N |
| XLogP | 5.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.23 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|