C35H51ClN2O4Si — CID 58139560
tert-butyl N-[(2S)-1-[[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 58139560) has the molecular formula C35H51ClN2O4Si and a molecular weight of 627.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58139560 |
| Molecular Formula | C35H51ClN2O4Si |
| Molecular Weight | 627.34 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(1Z,4R,6E)-4-[tert-butyl(diphenyl)silyl]oxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | C/C(Cl)=C\C[C@@H](C/C=C\NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H51ClN2O4Si/c1-26(36)23-24-27(18-17-25-37-31(39)30(33(2,3)4)38-32(40)41-34(5,6)7)42-43(35(8,9)10,28-19-13-11-14-20-28)29-21-15-12-16-22-29/h11-17,19-23,25,27,30H,18,24H2,1-10H3,(H,37,39)(H,38,40)/b25-17-,26-23+/t27-,30-/m1/s1 |
| InChIKey | DZTIKGCQOAAGRF-DCKIRFRMSA-N |
| XLogP | 7.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.34 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|