C28H40ClN3O6 — CID 58139579
[(1Z,4R,6E)-7-chloro-1-[[(2S)-3,3-dimethyl-2-[[(2Z,4Z,6S)-6-[(2S)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 58139579) has the molecular formula C28H40ClN3O6 and a molecular weight of 550.10 g/mol. Its IUPAC name is [(1Z,4R,6E)-7-chloro-1-[[(2S)-3,3-dimethyl-2-[[(2Z,4Z,6S)-6-[(2S)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(1Z,4R,6E)-7-chloro-1-[[(2S)-3,3-dimethyl-2-[[(2Z,4Z,6S)-6-[(2S)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 58139579 |
| Molecular Formula | C28H40ClN3O6 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | [(1Z,4R,6E)-7-chloro-1-[[(2S)-3,3-dimethyl-2-[[(2Z,4Z,6S)-6-[(2S)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | CC1=CC[C@@H]([C@@H](C)/C=C\C=C/C(=O)N[C@H](C(=O)N/C=C\C[C@H](C/C=C(\C)Cl)OC(N)=O)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C28H40ClN3O6/c1-18(22-16-13-19(2)26(35)38-22)10-7-8-12-23(33)32-24(28(4,5)6)25(34)31-17-9-11-21(37-27(30)36)15-14-20(3)29/h7-10,12-14,17-18,21-22,24H,11,15-16H2,1-6H3,(H2,30,36)(H,31,34)(H,32,33)/b10-7-,12-8-,17-9-,20-14+/t18-,21+,22-,24+/m0/s1 |
| InChIKey | OPZZKSZJQSTHCO-UUKFDDQPSA-N |
| XLogP | 4.54 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|