C21H39ClO2Si — CID 58139586
(3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,3-dimethyltrideca-6,11-dien-4-one (PubChem CID 58139586) has the molecular formula C21H39ClO2Si and a molecular weight of 387.08 g/mol. Its IUPAC name is (3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,3-dimethyltrideca-6,11-dien-4-one.
| Compound Name | (3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,3-dimethyltrideca-6,11-dien-4-one |
|---|---|
| PubChem CID | 58139586 |
| Molecular Formula | C21H39ClO2Si |
| Molecular Weight | 387.08 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,3-dimethyltrideca-6,11-dien-4-one |
| SMILES | C/C(Cl)=C\C[C@@H](C/C=C\CC(=O)[C@@H](C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39ClO2Si/c1-16(2)18(4)20(23)13-11-10-12-19(15-14-17(3)22)24-25(8,9)21(5,6)7/h10-11,14,16,18-19H,12-13,15H2,1-9H3/b11-10-,17-14+/t18-,19+/m0/s1 |
| InChIKey | BFNSMHYALNLZBW-SYPONUESSA-N |
| XLogP | 7.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.08 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|