C16H28O2Si — CID 58139600
(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-5-en-7-ynal (PubChem CID 58139600) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is (E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-5-en-7-ynal.
| Compound Name | (E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-5-en-7-ynal |
|---|---|
| PubChem CID | 58139600 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-5-en-7-ynal |
| SMILES | C#C/C(C)=C/[C@H](C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-9-13(2)12-14(3)15(10-11-17)18-19(7,8)16(4,5)6/h1,11-12,14-15H,10H2,2-8H3/b13-12+/t14-,15-/m0/s1 |
| InChIKey | BKZRSJDFGXIPLH-SWBCYVRMSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|