C30H42N2O2Si — CID 58139612
(2S)-2-amino-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxyoct-1-en-6-ynyl]-3,3-dimethylbutanamide (PubChem CID 58139612) has the molecular formula C30H42N2O2Si and a molecular weight of 490.76 g/mol. Its IUPAC name is (2S)-2-amino-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxyoct-1-en-6-ynyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxyoct-1-en-6-ynyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 58139612 |
| Molecular Formula | C30H42N2O2Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | (2S)-2-amino-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxyoct-1-en-6-ynyl]-3,3-dimethylbutanamide |
| SMILES | CC#CC[C@@H](C/C=C\NC(=O)[C@@H](N)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42N2O2Si/c1-8-9-17-24(18-16-23-32-28(33)27(31)29(2,3)4)34-35(30(5,6)7,25-19-12-10-13-20-25)26-21-14-11-15-22-26/h10-16,19-24,27H,17-18,31H2,1-7H3,(H,32,33)/b23-16-/t24-,27+/m0/s1 |
| InChIKey | QGOPWEBKMRVGRW-QJGHKKGGSA-N |
| XLogP | 4.74 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|