C34H44ClNO3Si — CID 58139622
N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide (PubChem CID 58139622) has the molecular formula C34H44ClNO3Si and a molecular weight of 578.27 g/mol. Its IUPAC name is N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide.
| Compound Name | N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide |
|---|---|
| PubChem CID | 58139622 |
| Molecular Formula | C34H44ClNO3Si |
| Molecular Weight | 578.27 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | N-[(3S,6Z,9R,11E)-9-[tert-butyl(diphenyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide |
| SMILES | C#CC(=O)N[C@H](C(=O)C/C=C\C[C@H](C/C=C(\C)Cl)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H44ClNO3Si/c1-9-31(38)36-32(33(3,4)5)30(37)23-17-16-18-27(25-24-26(2)35)39-40(34(6,7)8,28-19-12-10-13-20-28)29-21-14-11-15-22-29/h1,10-17,19-22,24,27,32H,18,23,25H2,2-8H3,(H,36,38)/b17-16-,26-24+/t27-,32-/m1/s1 |
| InChIKey | QFBIWWUCTSNLSG-HZZDJBOPSA-N |
| XLogP | 6.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.27 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|