C20H43IO2Si2 — CID 58139633
tert-butyl-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhept-5-enoxy]-dimethylsilane (PubChem CID 58139633) has the molecular formula C20H43IO2Si2 and a molecular weight of 498.64 g/mol. Its IUPAC name is tert-butyl-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58139633 |
| Molecular Formula | C20H43IO2Si2 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | tert-butyl-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhept-5-enoxy]-dimethylsilane |
| SMILES | C/C(I)=C\[C@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H43IO2Si2/c1-16(15-17(2)21)18(23-25(11,12)20(6,7)8)13-14-22-24(9,10)19(3,4)5/h15-16,18H,13-14H2,1-12H3/b17-15+/t16-,18-/m0/s1 |
| InChIKey | RKHZVSUDQOHNFY-YIBWVLRXSA-N |
| XLogP | 7.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|