C27H25N7OS — CID 58139887
6-[(4,4-dimethyl-5H-1,3-thiazol-2-yl)methyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine (PubChem CID 58139887) has the molecular formula C27H25N7OS and a molecular weight of 495.61 g/mol. Its IUPAC name is 6-[(4,4-dimethyl-5H-1,3-thiazol-2-yl)methyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine.
| Compound Name | 6-[(4,4-dimethyl-5H-1,3-thiazol-2-yl)methyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 58139887 |
| Molecular Formula | C27H25N7OS |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 6-[(4,4-dimethyl-5H-1,3-thiazol-2-yl)methyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc(CC4=NC(C)(C)CS4)cc23)ccc1Oc1ccn2ncnc2c1 |
| InChI | InChI=1S/C27H25N7OS/c1-17-10-19(5-7-23(17)35-20-8-9-34-24(13-20)29-16-31-34)32-26-21-11-18(4-6-22(21)28-15-30-26)12-25-33-27(2,3)14-36-25/h4-11,13,15-16H,12,14H2,1-3H3,(H,28,30,32) |
| InChIKey | UVVJWOIOUNQFDO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |