C10H20N2O — CID 58140113
N-tert-butyl-N,4,4-trimethyl-5H-1,3-oxazol-2-amine (PubChem CID 58140113) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N-tert-butyl-N,4,4-trimethyl-5H-1,3-oxazol-2-amine.
| Compound Name | N-tert-butyl-N,4,4-trimethyl-5H-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 58140113 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-tert-butyl-N,4,4-trimethyl-5H-1,3-oxazol-2-amine |
| SMILES | CN(C1=NC(C)(C)CO1)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O/c1-9(2,3)12(6)8-11-10(4,5)7-13-8/h7H2,1-6H3 |
| InChIKey | YVKJGUGICHVNQQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |