C24H26F3N3O2S — CID 58140249
N-[(R)-[1-tert-butyl-5-(2,4,5-trifluorophenyl)pyrazol-4-yl]-cyclopropylmethyl]-4-methylbenzenesulfonamide (PubChem CID 58140249) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[(R)-[1-tert-butyl-5-(2,4,5-trifluorophenyl)pyrazol-4-yl]-cyclopropylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(R)-[1-tert-butyl-5-(2,4,5-trifluorophenyl)pyrazol-4-yl]-cyclopropylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58140249 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[(R)-[1-tert-butyl-5-(2,4,5-trifluorophenyl)pyrazol-4-yl]-cyclopropylmethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2cnn(C(C)(C)C)c2-c2cc(F)c(F)cc2F)C2CC2)cc1 |
| InChI | InChI=1S/C24H26F3N3O2S/c1-14-5-9-16(10-6-14)33(31,32)29-22(15-7-8-15)18-13-28-30(24(2,3)4)23(18)17-11-20(26)21(27)12-19(17)25/h5-6,9-13,15,22,29H,7-8H2,1-4H3/t22-/m1/s1 |
| InChIKey | MTOKSMUNYLXDBV-JOCHJYFZSA-N |
| XLogP | 5.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|