About [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol
[2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol (PubChem CID 58140736) has the molecular formula C21H19F3O3
and a molecular weight of 376.37 g/mol. Its IUPAC name is [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol.
Molecular Properties
| Compound Name | [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol |
| PubChem CID | 58140736 |
| Molecular Formula | C21H19F3O3 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol |
| SMILES | COc1ccc(C2CCC(C#Cc3ccc(CO)c(F)c3F)OC2)cc1F |
| InChI | InChI=1S/C21H19F3O3/c1-26-19-9-6-14(10-18(19)22)16-5-8-17(27-12-16)7-4-13-2-3-15(11-25)21(24)20(13)23/h2-3,6,9-10,16-17,25H,5,8,11-12H2,1H3 |
| InChIKey | KGXHUYQNOKACJZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol?
The IUPAC name of [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol (CID 58140736) is [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol.
What is the SMILES notation for [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol?
The canonical SMILES for [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol is COc1ccc(C2CCC(C#Cc3ccc(CO)c(F)c3F)OC2)cc1F.
What is the InChIKey of [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol?
The InChIKey is KGXHUYQNOKACJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3O3/c1-26-19-9-6-14(10-18(19)22)16-5-8-17(27-12-16)7-4-13-2-3-15(11-25)21(24)20(13)23/h2-3,6,9-10,16-17,25H,5,8,11-12H2,1H3.
What are the key properties of [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol?
[2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol has a molecular weight of 376.37 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-difluoro-4-[2-[5-(3-fluoro-4-methoxyphenyl)oxan-2-yl]ethynyl]phenyl]methanol is sourced from PubChem (CID 58140736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).