About 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine
2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine (PubChem CID 58140812) has the molecular formula C23H22F3NO
and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine.
Molecular Properties
| Compound Name | 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine |
| PubChem CID | 58140812 |
| Molecular Formula | C23H22F3NO |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine |
| SMILES | CCOCc1ccc(-c2ccc(CCc3ccc(C)c(F)c3)cn2)c(F)c1F |
| InChI | InChI=1S/C23H22F3NO/c1-3-28-14-18-9-10-19(23(26)22(18)25)21-11-8-17(13-27-21)7-6-16-5-4-15(2)20(24)12-16/h4-5,8-13H,3,6-7,14H2,1-2H3 |
| InChIKey | HNEFYQSIPJLAPY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine?
The IUPAC name of 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine (CID 58140812) is 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine.
What is the SMILES notation for 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine?
The canonical SMILES for 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine is CCOCc1ccc(-c2ccc(CCc3ccc(C)c(F)c3)cn2)c(F)c1F.
What is the InChIKey of 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine?
The InChIKey is HNEFYQSIPJLAPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F3NO/c1-3-28-14-18-9-10-19(23(26)22(18)25)21-11-8-17(13-27-21)7-6-16-5-4-15(2)20(24)12-16/h4-5,8-13H,3,6-7,14H2,1-2H3.
What are the key properties of 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine?
2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine has a molecular weight of 385.43 g/mol, XLogP of 5.80, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(ethoxymethyl)-2,3-difluorophenyl]-5-[2-(3-fluoro-4-methylphenyl)ethyl]pyridine is sourced from PubChem (CID 58140812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).