C36H52O7 — CID 58142205
4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7-trimethyl-9-phenyldecane-2,4,6-tricarboxylate (PubChem CID 58142205) has the molecular formula C36H52O7 and a molecular weight of 596.81 g/mol. Its IUPAC name is 4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7-trimethyl-9-phenyldecane-2,4,6-tricarboxylate.
| Compound Name | 4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7-trimethyl-9-phenyldecane-2,4,6-tricarboxylate |
|---|---|
| PubChem CID | 58142205 |
| Molecular Formula | C36H52O7 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | 4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7-trimethyl-9-phenyldecane-2,4,6-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)c1ccccc1)C(=O)OC1CC2CC1C1CCCC21)C(=O)OC)C(=O)OCC1CO1 |
| InChI | InChI=1S/C36H52O7/c1-7-34(3,32(38)42-20-26-19-41-26)21-36(5,31(37)40-6)22-35(4,18-23(2)24-12-9-8-10-13-24)33(39)43-30-17-25-16-29(30)28-15-11-14-27(25)28/h8-10,12-13,23,25-30H,7,11,14-22H2,1-6H3 |
| InChIKey | OMGMXZOINXNRSF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|