C21H6Br2F18 — CID 58142239
2,7-dibromo-9-fluoro-9-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)fluorene (PubChem CID 58142239) has the molecular formula C21H6Br2F18 and a molecular weight of 760.05 g/mol. Its IUPAC name is 2,7-dibromo-9-fluoro-9-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)fluorene.
| Compound Name | 2,7-dibromo-9-fluoro-9-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)fluorene |
|---|---|
| PubChem CID | 58142239 |
| Molecular Formula | C21H6Br2F18 |
| Molecular Weight | 760.05 g/mol |
| Exact Mass | 757.85 |
| IUPAC Name | 2,7-dibromo-9-fluoro-9-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)fluorene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C21H6Br2F18/c22-7-1-3-9-10-4-2-8(23)6-12(10)13(24,11(9)5-7)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)19(35,36)20(37,38)21(39,40)41/h1-6H |
| InChIKey | UWPQLWMVFBOHQY-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.05 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|