About (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate
(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate (PubChem CID 58143152) has the molecular formula C11H15BrO4
and a molecular weight of 291.14 g/mol. Its IUPAC name is (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate.
Molecular Properties
| Compound Name | (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate |
| PubChem CID | 58143152 |
| Molecular Formula | C11H15BrO4 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate |
| SMILES | CC1CC2CC(C)(OC2=O)C1OC(=O)CBr |
| InChI | InChI=1S/C11H15BrO4/c1-6-3-7-4-11(2,16-10(7)14)9(6)15-8(13)5-12/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | FEDLEGUVPZJMRE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate?
The IUPAC name of (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate (CID 58143152) is (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate.
What is the SMILES notation for (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate?
The canonical SMILES for (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate is CC1CC2CC(C)(OC2=O)C1OC(=O)CBr.
What is the InChIKey of (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate?
The InChIKey is FEDLEGUVPZJMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO4/c1-6-3-7-4-11(2,16-10(7)14)9(6)15-8(13)5-12/h6-7,9H,3-5H2,1-2H3.
What are the key properties of (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate?
(3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate has a molecular weight of 291.14 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-bromoacetate is sourced from PubChem (CID 58143152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).