C23H30O4 — CID 58143246
(3'aS,4R,6'aR)-2'-(2,6-diethyl-4-methylphenyl)-3'-hydroxy-2,2-dimethylspiro[1,3-dioxolane-4,5'-3a,4,6,6a-tetrahydropentalene]-1'-one (PubChem CID 58143246) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (3'aS,4R,6'aR)-2'-(2,6-diethyl-4-methylphenyl)-3'-hydroxy-2,2-dimethylspiro[1,3-dioxolane-4,5'-3a,4,6,6a-tetrahydropentalene]-1'-one.
| Compound Name | (3'aS,4R,6'aR)-2'-(2,6-diethyl-4-methylphenyl)-3'-hydroxy-2,2-dimethylspiro[1,3-dioxolane-4,5'-3a,4,6,6a-tetrahydropentalene]-1'-one |
|---|---|
| PubChem CID | 58143246 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (3'aS,4R,6'aR)-2'-(2,6-diethyl-4-methylphenyl)-3'-hydroxy-2,2-dimethylspiro[1,3-dioxolane-4,5'-3a,4,6,6a-tetrahydropentalene]-1'-one |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(O)[C@H]2C[C@]3(COC(C)(C)O3)C[C@H]2C1=O |
| InChI | InChI=1S/C23H30O4/c1-6-14-8-13(3)9-15(7-2)18(14)19-20(24)16-10-23(11-17(16)21(19)25)12-26-22(4,5)27-23/h8-9,16-17,24H,6-7,10-12H2,1-5H3/t16-,17+,23+/m0/s1 |
| InChIKey | WWDXYWGEZXLSMN-YGKZAACZSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |