About 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one
4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one (PubChem CID 58143472) has the molecular formula C12H23NO3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one.
Molecular Properties
| Compound Name | 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one |
| PubChem CID | 58143472 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one |
| SMILES | CC(=O)CC(CC1CCS(=O)(=O)CC1)N(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-10(14)8-12(13(2)3)9-11-4-6-17(15,16)7-5-11/h11-12H,4-9H2,1-3H3 |
| InChIKey | CSLYPZQWFLXEGR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one?
The IUPAC name of 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one (CID 58143472) is 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one.
What is the SMILES notation for 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one?
The canonical SMILES for 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one is CC(=O)CC(CC1CCS(=O)(=O)CC1)N(C)C.
What is the InChIKey of 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one?
The InChIKey is CSLYPZQWFLXEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3S/c1-10(14)8-12(13(2)3)9-11-4-6-17(15,16)7-5-11/h11-12H,4-9H2,1-3H3.
What are the key properties of 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one?
4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one has a molecular weight of 261.39 g/mol, XLogP of 1.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-5-(1,1-dioxothian-4-yl)pentan-2-one is sourced from PubChem (CID 58143472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).