About (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one
(E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one (PubChem CID 58143608) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one.
Molecular Properties
| Compound Name | (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one |
| PubChem CID | 58143608 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one |
| SMILES | C/C(=C\[C@@H](CC(C)C)C(=O)C(C)C)CNC(C)C |
| InChI | InChI=1S/C16H31NO/c1-11(2)8-15(16(18)12(3)4)9-14(7)10-17-13(5)6/h9,11-13,15,17H,8,10H2,1-7H3/b14-9+/t15-/m1/s1 |
| InChIKey | GPLDFPWAOYIFMS-AAWPKVBNSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one?
The IUPAC name of (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one (CID 58143608) is (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one.
What is the SMILES notation for (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one?
The canonical SMILES for (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one is C/C(=C\[C@@H](CC(C)C)C(=O)C(C)C)CNC(C)C.
What is the InChIKey of (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one?
The InChIKey is GPLDFPWAOYIFMS-AAWPKVBNSA-N. The full InChI is InChI=1S/C16H31NO/c1-11(2)8-15(16(18)12(3)4)9-14(7)10-17-13(5)6/h9,11-13,15,17H,8,10H2,1-7H3/b14-9+/t15-/m1/s1.
What are the key properties of (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one?
(E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one has a molecular weight of 253.43 g/mol, XLogP of 3.82, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4R)-2,6-dimethyl-4-(2-methylpropyl)-7-(propan-2-ylamino)hept-5-en-3-one is sourced from PubChem (CID 58143608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).