C23H31NO5S — CID 58143753
6-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-8-ethylchromen-2-one (PubChem CID 58143753) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is 6-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-8-ethylchromen-2-one.
| Compound Name | 6-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-8-ethylchromen-2-one |
|---|---|
| PubChem CID | 58143753 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 6-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-8-ethylchromen-2-one |
| SMILES | CCc1cc(CC(=O)N2CCC(CS(=O)(=O)C(C)(C)C)CC2)cc2ccc(=O)oc12 |
| InChI | InChI=1S/C23H31NO5S/c1-5-18-12-17(13-19-6-7-21(26)29-22(18)19)14-20(25)24-10-8-16(9-11-24)15-30(27,28)23(2,3)4/h6-7,12-13,16H,5,8-11,14-15H2,1-4H3 |
| InChIKey | CLRIBNZWBKAPNL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|