About 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone
2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58143782) has the molecular formula C24H28F2O4S
and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
Molecular Properties
| Compound Name | 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| PubChem CID | 58143782 |
| Molecular Formula | C24H28F2O4S |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccccc2Oc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C24H28F2O4S/c1-16(2)31(28,29)15-17-7-9-18(10-8-17)22(27)13-19-5-3-4-6-23(19)30-24-12-11-20(25)14-21(24)26/h3-6,11-12,14,16-18H,7-10,13,15H2,1-2H3 |
| InChIKey | SGCISWZTGXHJLK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone?
The IUPAC name of 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (CID 58143782) is 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
What is the SMILES notation for 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone?
The canonical SMILES for 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone is CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccccc2Oc2ccc(F)cc2F)CC1.
What is the InChIKey of 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone?
The InChIKey is SGCISWZTGXHJLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F2O4S/c1-16(2)31(28,29)15-17-7-9-18(10-8-17)22(27)13-19-5-3-4-6-23(19)30-24-12-11-20(25)14-21(24)26/h3-6,11-12,14,16-18H,7-10,13,15H2,1-2H3.
What are the key properties of 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone?
2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone has a molecular weight of 450.55 g/mol, XLogP of 5.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-difluorophenoxy)phenyl]-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone is sourced from PubChem (CID 58143782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).