C23H36N2O4S — CID 58144649
N-butan-2-yl-4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 58144649) has the molecular formula C23H36N2O4S and a molecular weight of 436.62 g/mol. Its IUPAC name is N-butan-2-yl-4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-butan-2-yl-4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 58144649 |
| Molecular Formula | C23H36N2O4S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-butan-2-yl-4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(CC(=O)N2CCC(CS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H36N2O4S/c1-6-17(2)24-22(27)20-9-7-18(8-10-20)15-21(26)25-13-11-19(12-14-25)16-30(28,29)23(3,4)5/h7-10,17,19H,6,11-16H2,1-5H3,(H,24,27) |
| InChIKey | HRRXJOXUPHEXSS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |