C25H38N2O4S — CID 58144692
4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-N-cyclohexylbenzamide (PubChem CID 58144692) has the molecular formula C25H38N2O4S and a molecular weight of 462.66 g/mol. Its IUPAC name is 4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-N-cyclohexylbenzamide.
| Compound Name | 4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 58144692 |
| Molecular Formula | C25H38N2O4S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 4-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-N-cyclohexylbenzamide |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCN(C(=O)Cc2ccc(C(=O)NC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H38N2O4S/c1-25(2,3)32(30,31)18-20-13-15-27(16-14-20)23(28)17-19-9-11-21(12-10-19)24(29)26-22-7-5-4-6-8-22/h9-12,20,22H,4-8,13-18H2,1-3H3,(H,26,29) |
| InChIKey | NLQMHOBVXFVUIW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |