C20H26F4O4S — CID 58144797
1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone (PubChem CID 58144797) has the molecular formula C20H26F4O4S and a molecular weight of 438.48 g/mol. Its IUPAC name is 1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone.
| Compound Name | 1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 58144797 |
| Molecular Formula | C20H26F4O4S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2cccc(OC(F)(F)C(F)F)c2)CC1 |
| InChI | InChI=1S/C20H26F4O4S/c1-13(2)29(26,27)12-14-6-8-16(9-7-14)18(25)11-15-4-3-5-17(10-15)28-20(23,24)19(21)22/h3-5,10,13-14,16,19H,6-9,11-12H2,1-2H3 |
| InChIKey | RGOGMTKVJNBVIX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|