C22H34O3S — CID 58145118
7-tert-butylsulfonyl-1-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)heptan-2-one (PubChem CID 58145118) has the molecular formula C22H34O3S and a molecular weight of 378.58 g/mol. Its IUPAC name is 7-tert-butylsulfonyl-1-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)heptan-2-one.
| Compound Name | 7-tert-butylsulfonyl-1-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 58145118 |
| Molecular Formula | C22H34O3S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 7-tert-butylsulfonyl-1-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)heptan-2-one |
| SMILES | Cc1c(CC(=O)CCCCCS(=O)(=O)C(C)(C)C)ccc2c1CCC2C |
| InChI | InChI=1S/C22H34O3S/c1-16-10-12-21-17(2)18(11-13-20(16)21)15-19(23)9-7-6-8-14-26(24,25)22(3,4)5/h11,13,16H,6-10,12,14-15H2,1-5H3 |
| InChIKey | QNIHIOYCABRQRY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|