C18H24F4O4S — CID 58145704
7-propan-2-ylsulfonyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]heptan-2-one (PubChem CID 58145704) has the molecular formula C18H24F4O4S and a molecular weight of 412.45 g/mol. Its IUPAC name is 7-propan-2-ylsulfonyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]heptan-2-one.
| Compound Name | 7-propan-2-ylsulfonyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]heptan-2-one |
|---|---|
| PubChem CID | 58145704 |
| Molecular Formula | C18H24F4O4S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 7-propan-2-ylsulfonyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]heptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H24F4O4S/c1-13(2)27(24,25)10-5-3-4-8-15(23)11-14-7-6-9-16(12-14)26-18(21,22)17(19)20/h6-7,9,12-13,17H,3-5,8,10-11H2,1-2H3 |
| InChIKey | UHJVGDGNJQJAJT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|