C26H27N5O3 — CID 58146082
[3-[[6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl] formate (PubChem CID 58146082) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is [3-[[6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl] formate.
| Compound Name | [3-[[6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl] formate |
|---|---|
| PubChem CID | 58146082 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [3-[[6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl] formate |
| SMILES | O=COc1cccc(Nc2ncc3c(n2)-c2cc(CCCN4CCCC4)ccc2NC(=O)C3)c1 |
| InChI | InChI=1S/C26H27N5O3/c32-17-34-21-7-3-6-20(15-21)28-26-27-16-19-14-24(33)29-23-9-8-18(13-22(23)25(19)30-26)5-4-12-31-10-1-2-11-31/h3,6-9,13,15-17H,1-2,4-5,10-12,14H2,(H,29,33)(H,27,28,30) |
| InChIKey | MMKQDPCXCSPIEN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|