About 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine
2-[(2,5-dimethylfuran-3-yl)methyl]guanidine (PubChem CID 58146131) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine.
Molecular Properties
| Compound Name | 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine |
| PubChem CID | 58146131 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine |
| SMILES | Cc1cc(CN=C(N)N)c(C)o1 |
| InChI | InChI=1S/C8H13N3O/c1-5-3-7(6(2)12-5)4-11-8(9)10/h3H,4H2,1-2H3,(H4,9,10,11) |
| InChIKey | UUSLUUFXBZSWAK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine?
The IUPAC name of 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine (CID 58146131) is 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine.
What is the SMILES notation for 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine?
The canonical SMILES for 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine is Cc1cc(CN=C(N)N)c(C)o1.
What is the InChIKey of 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine?
The InChIKey is UUSLUUFXBZSWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-5-3-7(6(2)12-5)4-11-8(9)10/h3H,4H2,1-2H3,(H4,9,10,11).
What are the key properties of 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine?
2-[(2,5-dimethylfuran-3-yl)methyl]guanidine has a molecular weight of 167.21 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylfuran-3-yl)methyl]guanidine is sourced from PubChem (CID 58146131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).