About methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate
methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate (PubChem CID 58146196) has the molecular formula C22H22F2O5
and a molecular weight of 404.41 g/mol. Its IUPAC name is methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate |
| PubChem CID | 58146196 |
| Molecular Formula | C22H22F2O5 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate |
| SMILES | CCCC(=O)c1c(F)cc(Oc2cc(C(=O)OC)cc3c2CC(C)(C)O3)cc1F |
| InChI | InChI=1S/C22H22F2O5/c1-5-6-17(25)20-15(23)9-13(10-16(20)24)28-18-7-12(21(26)27-4)8-19-14(18)11-22(2,3)29-19/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | ZADQGVFOFIYMNK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate?
The IUPAC name of methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate (CID 58146196) is methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate.
What is the SMILES notation for methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate?
The canonical SMILES for methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate is CCCC(=O)c1c(F)cc(Oc2cc(C(=O)OC)cc3c2CC(C)(C)O3)cc1F.
What is the InChIKey of methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate?
The InChIKey is ZADQGVFOFIYMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2O5/c1-5-6-17(25)20-15(23)9-13(10-16(20)24)28-18-7-12(21(26)27-4)8-19-14(18)11-22(2,3)29-19/h7-10H,5-6,11H2,1-4H3.
What are the key properties of methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate?
methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate has a molecular weight of 404.41 g/mol, XLogP of 5.24, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-butanoyl-3,5-difluorophenoxy)-2,2-dimethyl-3H-1-benzofuran-6-carboxylate is sourced from PubChem (CID 58146196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).