About 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one
1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one (PubChem CID 58146338) has the molecular formula C21H25FN2O
and a molecular weight of 340.44 g/mol. Its IUPAC name is 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one |
| PubChem CID | 58146338 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one |
| SMILES | CCC(=O)c1cnc2c(c1NC1[C@@H]3CC4C[C@H]1CC(F)(C4)C3)C=CC2 |
| InChI | InChI=1S/C21H25FN2O/c1-2-18(25)16-11-23-17-5-3-4-15(17)20(16)24-19-13-6-12-7-14(19)10-21(22,8-12)9-13/h3-4,11-14,19H,2,5-10H2,1H3,(H,23,24)/t12?,13-,14+,19?,21? |
| InChIKey | HAFUWXSUFAWUMC-MIRYRMOTSA-N |
| XLogP | 4.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one?
The IUPAC name of 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one (CID 58146338) is 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one.
What is the SMILES notation for 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one?
The canonical SMILES for 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one is CCC(=O)c1cnc2c(c1NC1[C@@H]3CC4C[C@H]1CC(F)(C4)C3)C=CC2.
What is the InChIKey of 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one?
The InChIKey is HAFUWXSUFAWUMC-MIRYRMOTSA-N. The full InChI is InChI=1S/C21H25FN2O/c1-2-18(25)16-11-23-17-5-3-4-15(17)20(16)24-19-13-6-12-7-14(19)10-21(22,8-12)9-13/h3-4,11-14,19H,2,5-10H2,1H3,(H,23,24)/t12?,13-,14+,19?,21?.
What are the key properties of 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one?
1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one has a molecular weight of 340.44 g/mol, XLogP of 4.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[(1S,3R)-5-fluoro-2-adamantyl]amino]-7H-cyclopenta[b]pyridin-3-yl]propan-1-one is sourced from PubChem (CID 58146338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).