C27H32N4O3 — CID 58146659
3-[3-[(1S,3R)-5-hydroxy-2-adamantyl]-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-1-piperidin-1-ylpropane-1,2-dione (PubChem CID 58146659) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[3-[(1S,3R)-5-hydroxy-2-adamantyl]-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-1-piperidin-1-ylpropane-1,2-dione.
| Compound Name | 3-[3-[(1S,3R)-5-hydroxy-2-adamantyl]-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-1-piperidin-1-ylpropane-1,2-dione |
|---|---|
| PubChem CID | 58146659 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 3-[3-[(1S,3R)-5-hydroxy-2-adamantyl]-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-1-piperidin-1-ylpropane-1,2-dione |
| SMILES | O=C(Cc1nn(C2[C@@H]3CC4C[C@H]2CC(O)(C4)C3)c2c3c(ncc12)CC=C3)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C27H32N4O3/c32-23(26(33)30-7-2-1-3-8-30)11-22-20-15-28-21-6-4-5-19(21)25(20)31(29-22)24-17-9-16-10-18(24)14-27(34,12-16)13-17/h4-5,15-18,24,34H,1-3,6-14H2/t16?,17-,18+,24?,27? |
| InChIKey | MPRZZSPPBYNTAW-WCTJUMCNSA-N |
| XLogP | 3.24 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|