C22H22N6O3 — CID 58146895
5-[4-(4-oxo-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)-1-adamantyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 58146895) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 5-[4-(4-oxo-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)-1-adamantyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[4-(4-oxo-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)-1-adamantyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 58146895 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 5-[4-(4-oxo-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)-1-adamantyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)c1noc(C23CC4CC(C2)C(n2c(=O)[nH]c5cnc6c(c52)C=CC6)C(C4)C3)n1 |
| InChI | InChI=1S/C22H22N6O3/c23-18(29)19-26-20(31-27-19)22-6-10-4-11(7-22)16(12(5-10)8-22)28-17-13-2-1-3-14(13)24-9-15(17)25-21(28)30/h1-2,9-12,16H,3-8H2,(H2,23,29)(H,25,30) |
| InChIKey | RURSEGMIUYACOF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |