C20H25N3S — CID 58147006
5-[2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)ethyl]-4-methyl-1,3-thiazole (PubChem CID 58147006) has the molecular formula C20H25N3S and a molecular weight of 339.51 g/mol. Its IUPAC name is 5-[2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)ethyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)ethyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 58147006 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 5-[2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)ethyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2scnc2C)CCCN(C)C1 |
| InChI | InChI=1S/C20H25N3S/c1-14-6-7-19-16(11-14)17-12-22(3)9-4-5-18(17)23(19)10-8-20-15(2)21-13-24-20/h6-7,11,13H,4-5,8-10,12H2,1-3H3 |
| InChIKey | KDPUREROUGDBNW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|